About 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate
6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 87123761) has the molecular formula C26H27BrF2O5S2
and a molecular weight of 601.53 g/mol. Its IUPAC name is 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
Molecular Properties
| Compound Name | 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| PubChem CID | 87123761 |
| Molecular Formula | C26H27BrF2O5S2 |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 600.05 |
| IUPAC Name | 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | O=C(OCCCCCCBr)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27BrF2O5S2/c27-20-12-1-2-13-21-33-25(30)26(28,29)36(31,32)34-35(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,1-2,12-13,20-21H2 |
| InChIKey | IDSYBRJTGHWSEB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The IUPAC name of 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (CID 87123761) is 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
What is the SMILES notation for 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The canonical SMILES for 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is O=C(OCCCCCCBr)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The InChIKey is IDSYBRJTGHWSEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27BrF2O5S2/c27-20-12-1-2-13-21-33-25(30)26(28,29)36(31,32)34-35(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,1-2,12-13,20-21H2.
What are the key properties of 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate has a molecular weight of 601.53 g/mol, XLogP of 7.32, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromohexyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is sourced from PubChem (CID 87123761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).