About 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate
10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate (PubChem CID 87123786) has the molecular formula C33H41BrF2O5S2
and a molecular weight of 699.72 g/mol. Its IUPAC name is 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate.
Molecular Properties
| Compound Name | 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
| PubChem CID | 87123786 |
| Molecular Formula | C33H41BrF2O5S2 |
| Molecular Weight | 699.72 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
| SMILES | Cc1ccc(S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCCCCCBr)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C33H41BrF2O5S2/c1-26-12-18-29(19-13-26)42(30-20-14-27(2)15-21-30,31-22-16-28(3)17-23-31)41-43(38,39)33(35,36)32(37)40-25-11-9-7-5-4-6-8-10-24-34/h12-23H,4-11,24-25H2,1-3H3 |
| InChIKey | CWDZMMUFHOPONC-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 699.72 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
The IUPAC name of 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate (CID 87123786) is 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate.
What is the SMILES notation for 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
The canonical SMILES for 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate is Cc1ccc(S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCCCCCBr)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.
What is the InChIKey of 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
The InChIKey is CWDZMMUFHOPONC-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H41BrF2O5S2/c1-26-12-18-29(19-13-26)42(30-20-14-27(2)15-21-30,31-22-16-28(3)17-23-31)41-43(38,39)33(35,36)32(37)40-25-11-9-7-5-4-6-8-10-24-34/h12-23H,4-11,24-25H2,1-3H3.
What are the key properties of 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate has a molecular weight of 699.72 g/mol, XLogP of 9.81, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromodecyl 2,2-difluoro-2-[tris(4-methylphenyl)-λ4-sulfanyl]oxysulfonylacetate is sourced from PubChem (CID 87123786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).