About [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate
[(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate (PubChem CID 87123806) has the molecular formula C18H18F3NO3S
and a molecular weight of 385.41 g/mol. Its IUPAC name is [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate.
Molecular Properties
| Compound Name | [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate |
| PubChem CID | 87123806 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O/N=C(/c1ccc(Cc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3NO3S/c1-2-12-26(23,24)25-22-17(18(19,20)21)16-10-8-15(9-11-16)13-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3/b22-17- |
| InChIKey | UOFLNAJWGDQWOL-XLNRJJMWSA-N |
| XLogP | 4.30 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate?
The IUPAC name of [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate (CID 87123806) is [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate.
What is the SMILES notation for [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate?
The canonical SMILES for [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate is CCCS(=O)(=O)O/N=C(/c1ccc(Cc2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate?
The InChIKey is UOFLNAJWGDQWOL-XLNRJJMWSA-N. The full InChI is InChI=1S/C18H18F3NO3S/c1-2-12-26(23,24)25-22-17(18(19,20)21)16-10-8-15(9-11-16)13-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3/b22-17-.
What are the key properties of [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate?
[(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate has a molecular weight of 385.41 g/mol, XLogP of 4.30, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate is sourced from PubChem (CID 87123806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).