C24H15F13O3S2 — CID 87123851
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;triphenylsulfanium (PubChem CID 87123851) has the molecular formula C24H15F13O3S2 and a molecular weight of 662.49 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87123851 |
| Molecular Formula | C24H15F13O3S2 |
| Molecular Weight | 662.49 g/mol |
| Exact Mass | 662.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C6HF13O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h1-15H;(H,20,21,22)/q+1;/p-1 |
| InChIKey | GKPVBUQZIJAKRS-UHFFFAOYSA-M |
| XLogP | 8.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.49 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|