About 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate
6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate (PubChem CID 87123881) has the molecular formula C38H51BrF2O5S2
and a molecular weight of 769.85 g/mol. Its IUPAC name is 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate.
Molecular Properties
| Compound Name | 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
| PubChem CID | 87123881 |
| Molecular Formula | C38H51BrF2O5S2 |
| Molecular Weight | 769.85 g/mol |
| Exact Mass | 768.23 |
| IUPAC Name | 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
| SMILES | CC(C)(C)c1ccc(S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCBr)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H51BrF2O5S2/c1-35(2,3)28-14-20-31(21-15-28)47(32-22-16-29(17-23-32)36(4,5)6,33-24-18-30(19-25-33)37(7,8)9)46-48(43,44)38(40,41)34(42)45-27-13-11-10-12-26-39/h14-25H,10-13,26-27H2,1-9H3 |
| InChIKey | BFKIEMKNANZWGS-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 769.85 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
The IUPAC name of 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate (CID 87123881) is 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate.
What is the SMILES notation for 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
The canonical SMILES for 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate is CC(C)(C)c1ccc(S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCBr)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.
What is the InChIKey of 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
The InChIKey is BFKIEMKNANZWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H51BrF2O5S2/c1-35(2,3)28-14-20-31(21-15-28)47(32-22-16-29(17-23-32)36(4,5)6,33-24-18-30(19-25-33)37(7,8)9)46-48(43,44)38(40,41)34(42)45-27-13-11-10-12-26-39/h14-25H,10-13,26-27H2,1-9H3.
What are the key properties of 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate?
6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate has a molecular weight of 769.85 g/mol, XLogP of 11.21, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromohexyl 2,2-difluoro-2-[tris(4-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate is sourced from PubChem (CID 87123881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).