C22H27F5O6S2 — CID 87124024
2-(cyclohexanecarbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone (PubChem CID 87124024) has the molecular formula C22H27F5O6S2 and a molecular weight of 546.58 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone.
| Compound Name | 2-(cyclohexanecarbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 87124024 |
| Molecular Formula | C22H27F5O6S2 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 2-(cyclohexanecarbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone |
| SMILES | O=C(C[S+]1CCCC1)c1ccccc1.O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C12H15OS.C10H13F5O5S/c13-12(10-14-8-4-5-9-14)11-6-2-1-3-7-11;11-9(12,13)8(10(14,15)21(17,18)19)20-7(16)6-4-2-1-3-5-6/h1-3,6-7H,4-5,8-10H2;6,8H,1-5H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | NSKBEWBPRVYYHM-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|