About [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate
[[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate (PubChem CID 87124066) has the molecular formula C16H14F3NO3S
and a molecular weight of 357.35 g/mol. Its IUPAC name is [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate.
Molecular Properties
| Compound Name | [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate |
| PubChem CID | 87124066 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ON=C(c1ccc(Cc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO3S/c1-24(21,22)23-20-15(16(17,18)19)14-9-7-13(8-10-14)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | MYZSFPGVHMQWAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate?
The IUPAC name of [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate (CID 87124066) is [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate.
What is the SMILES notation for [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate?
The canonical SMILES for [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate is CS(=O)(=O)ON=C(c1ccc(Cc2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate?
The InChIKey is MYZSFPGVHMQWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO3S/c1-24(21,22)23-20-15(16(17,18)19)14-9-7-13(8-10-14)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3.
What are the key properties of [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate?
[[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate has a molecular weight of 357.35 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-(4-benzylphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate is sourced from PubChem (CID 87124066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).