C47H61BrF2O8S3 — CID 87124073
2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethanesulfonate;tris(2-tert-butylphenyl)sulfanium (PubChem CID 87124073) has the molecular formula C47H61BrF2O8S3 and a molecular weight of 968.10 g/mol. Its IUPAC name is 2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethanesulfonate;tris(2-tert-butylphenyl)sulfanium.
| Compound Name | 2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethanesulfonate;tris(2-tert-butylphenyl)sulfanium |
|---|---|
| PubChem CID | 87124073 |
| Molecular Formula | C47H61BrF2O8S3 |
| Molecular Weight | 968.10 g/mol |
| Exact Mass | 966.27 |
| IUPAC Name | 2-[9-(4-bromophenyl)sulfonyloxynonoxy]-1,1-difluoro-2-oxoethanesulfonate;tris(2-tert-butylphenyl)sulfanium |
| SMILES | CC(C)(C)c1ccccc1[S+](c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C.O=C(OCCCCCCCCCOS(=O)(=O)c1ccc(Br)cc1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C30H39S.C17H23BrF2O8S2/c1-28(2,3)22-16-10-13-19-25(22)31(26-20-14-11-17-23(26)29(4,5)6)27-21-15-12-18-24(27)30(7,8)9;18-14-8-10-15(11-9-14)29(22,23)28-13-7-5-3-1-2-4-6-12-27-16(21)17(19,20)30(24,25)26/h10-21H,1-9H3;8-11H,1-7,12-13H2,(H,24,25,26)/q+1;/p-1 |
| InChIKey | TXYDLRFXDWXVRU-UHFFFAOYSA-M |
| XLogP | 12.24 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.10 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|