About 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde
5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde (PubChem CID 87124357) has the molecular formula C18H11N3O3
and a molecular weight of 317.30 g/mol. Its IUPAC name is 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde.
Molecular Properties
| Compound Name | 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde |
| PubChem CID | 87124357 |
| Molecular Formula | C18H11N3O3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde |
| SMILES | O=Cc1nc(-c2ccccn2)c(-c2ccccn2)c(C=O)c1C=O |
| InChI | InChI=1S/C18H11N3O3/c22-9-12-13(10-23)17(14-5-1-3-7-19-14)18(21-16(12)11-24)15-6-2-4-8-20-15/h1-11H |
| InChIKey | FFOMJKDYLJOWIJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde?
The IUPAC name of 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde (CID 87124357) is 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde.
What is the SMILES notation for 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde?
The canonical SMILES for 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde is O=Cc1nc(-c2ccccn2)c(-c2ccccn2)c(C=O)c1C=O.
What is the InChIKey of 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde?
The InChIKey is FFOMJKDYLJOWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O3/c22-9-12-13(10-23)17(14-5-1-3-7-19-14)18(21-16(12)11-24)15-6-2-4-8-20-15/h1-11H.
What are the key properties of 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde?
5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde has a molecular weight of 317.30 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dipyridin-2-ylpyridine-2,3,4-tricarbaldehyde is sourced from PubChem (CID 87124357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).