About anthracene-1,2,3,4-tetracarbaldehyde
anthracene-1,2,3,4-tetracarbaldehyde (PubChem CID 87124414) has the molecular formula C18H10O4
and a molecular weight of 290.27 g/mol. Its IUPAC name is anthracene-1,2,3,4-tetracarbaldehyde.
Molecular Properties
| Compound Name | anthracene-1,2,3,4-tetracarbaldehyde |
| PubChem CID | 87124414 |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | anthracene-1,2,3,4-tetracarbaldehyde |
| SMILES | O=Cc1c(C=O)c(C=O)c2cc3ccccc3cc2c1C=O |
| InChI | InChI=1S/C18H10O4/c19-7-15-13-5-11-3-1-2-4-12(11)6-14(13)16(8-20)18(10-22)17(15)9-21/h1-10H |
| InChIKey | CXDZAUVCVAJFOJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-1,2,3,4-tetracarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-1,2,3,4-tetracarbaldehyde?
The IUPAC name of anthracene-1,2,3,4-tetracarbaldehyde (CID 87124414) is anthracene-1,2,3,4-tetracarbaldehyde.
What is the SMILES notation for anthracene-1,2,3,4-tetracarbaldehyde?
The canonical SMILES for anthracene-1,2,3,4-tetracarbaldehyde is O=Cc1c(C=O)c(C=O)c2cc3ccccc3cc2c1C=O.
What is the InChIKey of anthracene-1,2,3,4-tetracarbaldehyde?
The InChIKey is CXDZAUVCVAJFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10O4/c19-7-15-13-5-11-3-1-2-4-12(11)6-14(13)16(8-20)18(10-22)17(15)9-21/h1-10H.
What are the key properties of anthracene-1,2,3,4-tetracarbaldehyde?
anthracene-1,2,3,4-tetracarbaldehyde has a molecular weight of 290.27 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-1,2,3,4-tetracarbaldehyde is sourced from PubChem (CID 87124414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).