About 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane
2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (PubChem CID 87124676) has the molecular formula C32H42O4
and a molecular weight of 490.68 g/mol. Its IUPAC name is 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| PubChem CID | 87124676 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| SMILES | c1c(OCC2CO2)cc(C23CC4CC(CC(C4)C2)C3)c(OCC2CO2)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H42O4/c1-19-2-21-3-20(1)10-31(9-19,11-21)28-7-25(33-15-26-16-34-26)8-29(30(28)36-18-27-17-35-27)32-12-22-4-23(13-32)6-24(5-22)14-32/h7-8,19-24,26-27H,1-6,9-18H2 |
| InChIKey | CYNQZBJXCHRQLW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane?
The IUPAC name of 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (CID 87124676) is 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
What is the SMILES notation for 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane?
The canonical SMILES for 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is c1c(OCC2CO2)cc(C23CC4CC(CC(C4)C2)C3)c(OCC2CO2)c1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane?
The InChIKey is CYNQZBJXCHRQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H42O4/c1-19-2-21-3-20(1)10-31(9-19,11-21)28-7-25(33-15-26-16-34-26)8-29(30(28)36-18-27-17-35-27)32-12-22-4-23(13-32)6-24(5-22)14-32/h7-8,19-24,26-27H,1-6,9-18H2.
What are the key properties of 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane?
2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane has a molecular weight of 490.68 g/mol, XLogP of 6.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-bis(1-adamantyl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is sourced from PubChem (CID 87124676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).