C36H48O2 — CID 87124845
2,4,5-tris(1-adamantyl)benzene-1,3-diol (PubChem CID 87124845) has the molecular formula C36H48O2 and a molecular weight of 512.78 g/mol. Its IUPAC name is 2,4,5-tris(1-adamantyl)benzene-1,3-diol.
| Compound Name | 2,4,5-tris(1-adamantyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 87124845 |
| Molecular Formula | C36H48O2 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | 2,4,5-tris(1-adamantyl)benzene-1,3-diol |
| SMILES | Oc1cc(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c(O)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H48O2/c37-30-10-29(34-11-20-1-21(12-34)3-22(2-20)13-34)31(35-14-23-4-24(15-35)6-25(5-23)16-35)33(38)32(30)36-17-26-7-27(18-36)9-28(8-26)19-36/h10,20-28,37-38H,1-9,11-19H2 |
| InChIKey | OUORSLSOTINGEE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |