C50H68O2 — CID 87124967
2-[1-[2,3,4,5-tetrakis(1-adamantyl)phenoxy]ethyl]oxirane (PubChem CID 87124967) has the molecular formula C50H68O2 and a molecular weight of 701.09 g/mol. Its IUPAC name is 2-[1-[2,3,4,5-tetrakis(1-adamantyl)phenoxy]ethyl]oxirane.
| Compound Name | 2-[1-[2,3,4,5-tetrakis(1-adamantyl)phenoxy]ethyl]oxirane |
|---|---|
| PubChem CID | 87124967 |
| Molecular Formula | C50H68O2 |
| Molecular Weight | 701.09 g/mol |
| Exact Mass | 700.52 |
| IUPAC Name | 2-[1-[2,3,4,5-tetrakis(1-adamantyl)phenoxy]ethyl]oxirane |
| SMILES | CC(Oc1cc(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c1C12CC3CC(CC(C3)C1)C2)C1CO1 |
| InChI | InChI=1S/C50H68O2/c1-28(43-27-51-43)52-42-14-41(47-15-29-2-30(16-47)4-31(3-29)17-47)44(48-18-32-5-33(19-48)7-34(6-32)20-48)46(50-24-38-11-39(25-50)13-40(12-38)26-50)45(42)49-21-35-8-36(22-49)10-37(9-35)23-49/h14,28-40,43H,2-13,15-27H2,1H3 |
| InChIKey | YWKTTWIWQACEQP-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.09 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|