C17H15N3O3 — CID 8712515
N-(2,5-dimethylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 8712515) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 8712515 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C17H15N3O3/c1-9-3-4-10(2)13(7-9)19-15(21)11-5-6-12-14(8-11)20-17(23)16(22)18-12/h3-8H,1-2H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | YBQVIYHZGRGXEH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|