C22H27NO3 — CID 87125302
4-(4-tert-butylphenoxy)-N,N-bis(oxiran-2-ylmethyl)aniline (PubChem CID 87125302) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N,N-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 4-(4-tert-butylphenoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 87125302 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-22(2,3)16-4-8-18(9-5-16)26-19-10-6-17(7-11-19)23(12-20-14-24-20)13-21-15-25-21/h4-11,20-21H,12-15H2,1-3H3 |
| InChIKey | YXFXYFVEDLLAOJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|