About trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane
trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane (PubChem CID 87125332) has the molecular formula C8H17F3O3SSi
and a molecular weight of 278.37 g/mol. Its IUPAC name is trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane.
Molecular Properties
| Compound Name | trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane |
| PubChem CID | 87125332 |
| Molecular Formula | C8H17F3O3SSi |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane |
| SMILES | CO[Si](CCSCCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C8H17F3O3SSi/c1-12-16(13-2,14-3)7-6-15-5-4-8(9,10)11/h4-7H2,1-3H3 |
| InChIKey | POOJIYOOXPNLRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane?
The IUPAC name of trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane (CID 87125332) is trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane.
What is the SMILES notation for trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane?
The canonical SMILES for trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane is CO[Si](CCSCCC(F)(F)F)(OC)OC.
What is the InChIKey of trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane?
The InChIKey is POOJIYOOXPNLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3O3SSi/c1-12-16(13-2,14-3)7-6-15-5-4-8(9,10)11/h4-7H2,1-3H3.
What are the key properties of trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane?
trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane has a molecular weight of 278.37 g/mol, XLogP of 2.55, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]silane is sourced from PubChem (CID 87125332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).