C11H14N4O5S — CID 87126136
[2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoyl] 1,3-thiazolidine-4-carboxylate (PubChem CID 87126136) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is [2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoyl] 1,3-thiazolidine-4-carboxylate.
| Compound Name | [2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoyl] 1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 87126136 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [2-amino-3-(2,4-dioxopyrimidin-1-yl)propanoyl] 1,3-thiazolidine-4-carboxylate |
| SMILES | NC(Cn1ccc(=O)[nH]c1=O)C(=O)OC(=O)C1CSCN1 |
| InChI | InChI=1S/C11H14N4O5S/c12-6(3-15-2-1-8(16)14-11(15)19)9(17)20-10(18)7-4-21-5-13-7/h1-2,6-7,13H,3-5,12H2,(H,14,16,19) |
| InChIKey | WLVJCHLIGJMCFH-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|