C21H16F6NO4S3+ — CID 87126141
4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide;triphenylsulfanium (PubChem CID 87126141) has the molecular formula C21H16F6NO4S3+ and a molecular weight of 556.55 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide;triphenylsulfanium.
| Compound Name | 4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide;triphenylsulfanium |
|---|---|
| PubChem CID | 87126141 |
| Molecular Formula | C21H16F6NO4S3+ |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | 4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide;triphenylsulfanium |
| SMILES | O=S1(=O)NS(=O)(=O)C(F)(F)C(F)(F)C1(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3HF6NO4S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-1(5)2(6,7)15(11,12)10-16(13,14)3(1,8)9/h1-15H;10H/q+1; |
| InChIKey | RDVQQLFCDHSWJY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|