C21H15F6NO4S3 — CID 87126142
(4,4,5,5,6,6-hexafluoro-1,1,3,3-tetraoxo-1,3,2-dithiazinan-2-yl)-triphenyl-λ4-sulfane (PubChem CID 87126142) has the molecular formula C21H15F6NO4S3 and a molecular weight of 555.54 g/mol. Its IUPAC name is (4,4,5,5,6,6-hexafluoro-1,1,3,3-tetraoxo-1,3,2-dithiazinan-2-yl)-triphenyl-λ4-sulfane.
| Compound Name | (4,4,5,5,6,6-hexafluoro-1,1,3,3-tetraoxo-1,3,2-dithiazinan-2-yl)-triphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 87126142 |
| Molecular Formula | C21H15F6NO4S3 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | (4,4,5,5,6,6-hexafluoro-1,1,3,3-tetraoxo-1,3,2-dithiazinan-2-yl)-triphenyl-λ4-sulfane |
| SMILES | O=S1(=O)N(S(c2ccccc2)(c2ccccc2)c2ccccc2)S(=O)(=O)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H15F6NO4S3/c22-19(23)20(24,25)34(29,30)28(35(31,32)21(19,26)27)33(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | WLPNMZSYPOJJJY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|