C35H38F4O5S2 — CID 87126247
3-(adamantane-2-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium (PubChem CID 87126247) has the molecular formula C35H38F4O5S2 and a molecular weight of 678.81 g/mol. Its IUPAC name is 3-(adamantane-2-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium.
| Compound Name | 3-(adamantane-2-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87126247 |
| Molecular Formula | C35H38F4O5S2 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | 3-(adamantane-2-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium |
| SMILES | CCCC(OC(=O)C1C2CC3CC(C2)CC1C3)C(F)(F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C17H24F4O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-13(16(18,19)17(20,21)27(23,24)25)26-15(22)14-11-5-9-4-10(7-11)8-12(14)6-9/h1-15H;9-14H,2-8H2,1H3,(H,23,24,25)/q+1;/p-1 |
| InChIKey | KZQSCDGGLCPMPB-UHFFFAOYSA-M |
| XLogP | 8.33 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|