2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid

C10H10O8S2 — CID 87126447

IUPAC2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid
SMILESO=S(=O)(O)c1ccc2c(c1)=CC(O)(S(=O)(=O)O)C(O)C=2
InChIInChI=1S/C10H10O8S2/c11-9-4-6-1-2-8(19(13,14)15)3-7(6)5-10(9,12)20(16,17)18/h1-5,9,11-12H,(H,13,14,15)(H,16,17,18)
InChIKeyIRNSSIKYLBGVCL-UHFFFAOYSA-N
MW322.32 g/mol
LogP-2.55
Rot. Bonds2

About 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid

2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid (PubChem CID 87126447) has the molecular formula C10H10O8S2 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid.

Molecular Properties

Compound Name2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid
PubChem CID87126447
Molecular FormulaC10H10O8S2
Molecular Weight322.32 g/mol
Exact Mass321.98
IUPAC Name2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid
SMILESO=S(=O)(O)c1ccc2c(c1)=CC(O)(S(=O)(=O)O)C(O)C=2
InChIInChI=1S/C10H10O8S2/c11-9-4-6-1-2-8(19(13,14)15)3-7(6)5-10(9,12)20(16,17)18/h1-5,9,11-12H,(H,13,14,15)(H,16,17,18)
InChIKeyIRNSSIKYLBGVCL-UHFFFAOYSA-N
XLogP-2.55
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.32
LogP ≤ 5-2.55
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid?
The IUPAC name of 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid (CID 87126447) is 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid.
What is the SMILES notation for 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid?
The canonical SMILES for 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid is O=S(=O)(O)c1ccc2c(c1)=CC(O)(S(=O)(=O)O)C(O)C=2.
What is the InChIKey of 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid?
The InChIKey is IRNSSIKYLBGVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O8S2/c11-9-4-6-1-2-8(19(13,14)15)3-7(6)5-10(9,12)20(16,17)18/h1-5,9,11-12H,(H,13,14,15)(H,16,17,18).
What are the key properties of 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid?
2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid has a molecular weight of 322.32 g/mol, XLogP of -2.55, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-3H-naphthalene-2,7-disulfonic acid is sourced from PubChem (CID 87126447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).