About 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate
1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate (PubChem CID 87126500) has the molecular formula C19H24F3NO3S
and a molecular weight of 403.47 g/mol. Its IUPAC name is 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate |
| PubChem CID | 87126500 |
| Molecular Formula | C19H24F3NO3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate |
| SMILES | Cc1ccc[n+](Cc2ccccc2C(C)(C)C)c1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H24N.CHF3O3S/c1-14-9-8-12-19(15(14)2)13-16-10-6-7-11-17(16)18(3,4)5;2-1(3,4)8(5,6)7/h6-12H,13H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SVDQIRQFPHBURW-UHFFFAOYSA-M |
| XLogP | 3.99 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate?
The IUPAC name of 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate (CID 87126500) is 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate.
What is the SMILES notation for 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate?
The canonical SMILES for 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate is Cc1ccc[n+](Cc2ccccc2C(C)(C)C)c1C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate?
The InChIKey is SVDQIRQFPHBURW-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H24N.CHF3O3S/c1-14-9-8-12-19(15(14)2)13-16-10-6-7-11-17(16)18(3,4)5;2-1(3,4)8(5,6)7/h6-12H,13H2,1-5H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate?
1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate has a molecular weight of 403.47 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-tert-butylphenyl)methyl]-2,3-dimethylpyridin-1-ium;trifluoromethanesulfonate is sourced from PubChem (CID 87126500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).