About ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride
ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride (PubChem CID 87126587) has the molecular formula C12H25ClN2O2
and a molecular weight of 264.80 g/mol. Its IUPAC name is ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride.
Molecular Properties
| Compound Name | ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride |
| PubChem CID | 87126587 |
| Molecular Formula | C12H25ClN2O2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.C=CO.[Cl-] |
| InChI | InChI=1S/C10H20N2O.C2H4O.ClH/c1-9(2)10(13)11-7-6-8-12(3,4)5;1-2-3;/h1,6-8H2,2-5H3;2-3H,1H2;1H |
| InChIKey | WIJWCXDJPNJJMP-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride?
The IUPAC name of ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride (CID 87126587) is ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride.
What is the SMILES notation for ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride?
The canonical SMILES for ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride is C=C(C)C(=O)NCCC[N+](C)(C)C.C=CO.[Cl-].
What is the InChIKey of ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride?
The InChIKey is WIJWCXDJPNJJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.C2H4O.ClH/c1-9(2)10(13)11-7-6-8-12(3,4)5;1-2-3;/h1,6-8H2,2-5H3;2-3H,1H2;1H.
What are the key properties of ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride?
ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride has a molecular weight of 264.80 g/mol, XLogP of -1.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride is sourced from PubChem (CID 87126587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).