About 9-pentyl-4H-quinolizine
9-pentyl-4H-quinolizine (PubChem CID 87126698) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 9-pentyl-4H-quinolizine.
Molecular Properties
| Compound Name | 9-pentyl-4H-quinolizine |
| PubChem CID | 87126698 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 9-pentyl-4H-quinolizine |
| SMILES | CCCCCC1=CC=CN2CC=CC=C12 |
| InChI | InChI=1S/C14H19N/c1-2-3-4-8-13-9-7-12-15-11-6-5-10-14(13)15/h5-7,9-10,12H,2-4,8,11H2,1H3 |
| InChIKey | FGYOWFJTTDXDRU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-pentyl-4H-quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pentyl-4H-quinolizine?
The IUPAC name of 9-pentyl-4H-quinolizine (CID 87126698) is 9-pentyl-4H-quinolizine.
What is the SMILES notation for 9-pentyl-4H-quinolizine?
The canonical SMILES for 9-pentyl-4H-quinolizine is CCCCCC1=CC=CN2CC=CC=C12.
What is the InChIKey of 9-pentyl-4H-quinolizine?
The InChIKey is FGYOWFJTTDXDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-3-4-8-13-9-7-12-15-11-6-5-10-14(13)15/h5-7,9-10,12H,2-4,8,11H2,1H3.
What are the key properties of 9-pentyl-4H-quinolizine?
9-pentyl-4H-quinolizine has a molecular weight of 201.31 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pentyl-4H-quinolizine is sourced from PubChem (CID 87126698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).