C16H24O9 — CID 87127209
[(2R,3S,4R,5S)-3,4,5-triacetyloxy-5-methyl-1-oxoheptan-2-yl] acetate (PubChem CID 87127209) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4,5-triacetyloxy-5-methyl-1-oxoheptan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4,5-triacetyloxy-5-methyl-1-oxoheptan-2-yl] acetate |
|---|---|
| PubChem CID | 87127209 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4,5-triacetyloxy-5-methyl-1-oxoheptan-2-yl] acetate |
| SMILES | CC[C@](C)(OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](C=O)OC(C)=O |
| InChI | InChI=1S/C16H24O9/c1-7-16(6,25-12(5)21)15(24-11(4)20)14(23-10(3)19)13(8-17)22-9(2)18/h8,13-15H,7H2,1-6H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | WEWHNNBUDQIXMI-JJXSEGSLSA-N |
| XLogP | 0.71 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|