About phenyl(trimethoxysilyl)methanethiol;silver
phenyl(trimethoxysilyl)methanethiol;silver (PubChem CID 87127480) has the molecular formula C10H16AgO3SSi
and a molecular weight of 352.26 g/mol. Its IUPAC name is phenyl(trimethoxysilyl)methanethiol;silver.
Molecular Properties
| Compound Name | phenyl(trimethoxysilyl)methanethiol;silver |
| PubChem CID | 87127480 |
| Molecular Formula | C10H16AgO3SSi |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | phenyl(trimethoxysilyl)methanethiol;silver |
| SMILES | CO[Si](OC)(OC)C(S)c1ccccc1.[Ag] |
| InChI | InChI=1S/C10H16O3SSi.Ag/c1-11-15(12-2,13-3)10(14)9-7-5-4-6-8-9;/h4-8,10,14H,1-3H3; |
| InChIKey | SBWFQLCDOWAZRI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl(trimethoxysilyl)methanethiol;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(trimethoxysilyl)methanethiol;silver?
The IUPAC name of phenyl(trimethoxysilyl)methanethiol;silver (CID 87127480) is phenyl(trimethoxysilyl)methanethiol;silver.
What is the SMILES notation for phenyl(trimethoxysilyl)methanethiol;silver?
The canonical SMILES for phenyl(trimethoxysilyl)methanethiol;silver is CO[Si](OC)(OC)C(S)c1ccccc1.[Ag].
What is the InChIKey of phenyl(trimethoxysilyl)methanethiol;silver?
The InChIKey is SBWFQLCDOWAZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3SSi.Ag/c1-11-15(12-2,13-3)10(14)9-7-5-4-6-8-9;/h4-8,10,14H,1-3H3;.
What are the key properties of phenyl(trimethoxysilyl)methanethiol;silver?
phenyl(trimethoxysilyl)methanethiol;silver has a molecular weight of 352.26 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(trimethoxysilyl)methanethiol;silver is sourced from PubChem (CID 87127480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).