About 3-benzyl-4,6-dihydrothieno[2,3-b]indole
3-benzyl-4,6-dihydrothieno[2,3-b]indole (PubChem CID 87127645) has the molecular formula C17H15NS
and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-benzyl-4,6-dihydrothieno[2,3-b]indole.
Molecular Properties
| Compound Name | 3-benzyl-4,6-dihydrothieno[2,3-b]indole |
| PubChem CID | 87127645 |
| Molecular Formula | C17H15NS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-benzyl-4,6-dihydrothieno[2,3-b]indole |
| SMILES | C1=Cc2c3c([nH]c2=CC1)=S(Cc1ccccc1)C=C3 |
| InChI | InChI=1S/C17H15NS/c1-2-6-13(7-3-1)12-19-11-10-15-14-8-4-5-9-16(14)18-17(15)19/h1-4,6-11,18H,5,12H2 |
| InChIKey | SECNLOPJRBZXJZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4,6-dihydrothieno[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4,6-dihydrothieno[2,3-b]indole?
The IUPAC name of 3-benzyl-4,6-dihydrothieno[2,3-b]indole (CID 87127645) is 3-benzyl-4,6-dihydrothieno[2,3-b]indole.
What is the SMILES notation for 3-benzyl-4,6-dihydrothieno[2,3-b]indole?
The canonical SMILES for 3-benzyl-4,6-dihydrothieno[2,3-b]indole is C1=Cc2c3c([nH]c2=CC1)=S(Cc1ccccc1)C=C3.
What is the InChIKey of 3-benzyl-4,6-dihydrothieno[2,3-b]indole?
The InChIKey is SECNLOPJRBZXJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NS/c1-2-6-13(7-3-1)12-19-11-10-15-14-8-4-5-9-16(14)18-17(15)19/h1-4,6-11,18H,5,12H2.
What are the key properties of 3-benzyl-4,6-dihydrothieno[2,3-b]indole?
3-benzyl-4,6-dihydrothieno[2,3-b]indole has a molecular weight of 265.38 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4,6-dihydrothieno[2,3-b]indole is sourced from PubChem (CID 87127645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).