About 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane
1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane (PubChem CID 87127854) has the molecular formula C10H14F7O3P
and a molecular weight of 346.18 g/mol. Its IUPAC name is 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane.
Molecular Properties
| Compound Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane |
| PubChem CID | 87127854 |
| Molecular Formula | C10H14F7O3P |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane |
| SMILES | O=P(OCC(F)(F)F)(OCC(F)(F)F)C1CCCCC1F |
| InChI | InChI=1S/C10H14F7O3P/c11-7-3-1-2-4-8(7)21(18,19-5-9(12,13)14)20-6-10(15,16)17/h7-8H,1-6H2 |
| InChIKey | MMFCUZFPCPQHMW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane?
The IUPAC name of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane (CID 87127854) is 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane.
What is the SMILES notation for 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane?
The canonical SMILES for 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane is O=P(OCC(F)(F)F)(OCC(F)(F)F)C1CCCCC1F.
What is the InChIKey of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane?
The InChIKey is MMFCUZFPCPQHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F7O3P/c11-7-3-1-2-4-8(7)21(18,19-5-9(12,13)14)20-6-10(15,16)17/h7-8H,1-6H2.
What are the key properties of 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane?
1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane has a molecular weight of 346.18 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-fluorocyclohexane is sourced from PubChem (CID 87127854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).