C9H16F8O8S2 — CID 87127936
propane-1,2-diol;bis(1,1,1,2-tetrafluoropropane-2-sulfonic acid) (PubChem CID 87127936) has the molecular formula C9H16F8O8S2 and a molecular weight of 468.34 g/mol. Its IUPAC name is propane-1,2-diol;bis(1,1,1,2-tetrafluoropropane-2-sulfonic acid).
| Compound Name | propane-1,2-diol;bis(1,1,1,2-tetrafluoropropane-2-sulfonic acid) |
|---|---|
| PubChem CID | 87127936 |
| Molecular Formula | C9H16F8O8S2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | propane-1,2-diol;bis(1,1,1,2-tetrafluoropropane-2-sulfonic acid) |
| SMILES | CC(F)(C(F)(F)F)S(=O)(=O)O.CC(F)(C(F)(F)F)S(=O)(=O)O.CC(O)CO |
| InChI | InChI=1S/2C3H4F4O3S.C3H8O2/c2*1-2(4,3(5,6)7)11(8,9)10;1-3(5)2-4/h2*1H3,(H,8,9,10);3-5H,2H2,1H3 |
| InChIKey | MXLAWDGALGGDPZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|