1-isocyanatoethyl methyl hydrogen phosphate

C4H8NO5P — CID 87127951

IUPAC1-isocyanatoethyl methyl hydrogen phosphate
SMILESCOP(=O)(O)OC(C)N=C=O
InChIInChI=1S/C4H8NO5P/c1-4(5-3-6)10-11(7,8)9-2/h4H,1-2H3,(H,7,8)
InChIKeyJNYNBKIVLOFQGY-UHFFFAOYSA-N
MW181.08 g/mol
LogP0.43
Rot. Bonds4

About 1-isocyanatoethyl methyl hydrogen phosphate

1-isocyanatoethyl methyl hydrogen phosphate (PubChem CID 87127951) has the molecular formula C4H8NO5P and a molecular weight of 181.08 g/mol. Its IUPAC name is 1-isocyanatoethyl methyl hydrogen phosphate.

Molecular Properties

Compound Name1-isocyanatoethyl methyl hydrogen phosphate
PubChem CID87127951
Molecular FormulaC4H8NO5P
Molecular Weight181.08 g/mol
Exact Mass181.01
IUPAC Name1-isocyanatoethyl methyl hydrogen phosphate
SMILESCOP(=O)(O)OC(C)N=C=O
InChIInChI=1S/C4H8NO5P/c1-4(5-3-6)10-11(7,8)9-2/h4H,1-2H3,(H,7,8)
InChIKeyJNYNBKIVLOFQGY-UHFFFAOYSA-N
XLogP0.43
TPSA85.19 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.08
LogP ≤ 50.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-isocyanatoethyl methyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-isocyanatoethyl methyl hydrogen phosphate?
The IUPAC name of 1-isocyanatoethyl methyl hydrogen phosphate (CID 87127951) is 1-isocyanatoethyl methyl hydrogen phosphate.
What is the SMILES notation for 1-isocyanatoethyl methyl hydrogen phosphate?
The canonical SMILES for 1-isocyanatoethyl methyl hydrogen phosphate is COP(=O)(O)OC(C)N=C=O.
What is the InChIKey of 1-isocyanatoethyl methyl hydrogen phosphate?
The InChIKey is JNYNBKIVLOFQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO5P/c1-4(5-3-6)10-11(7,8)9-2/h4H,1-2H3,(H,7,8).
What are the key properties of 1-isocyanatoethyl methyl hydrogen phosphate?
1-isocyanatoethyl methyl hydrogen phosphate has a molecular weight of 181.08 g/mol, XLogP of 0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatoethyl methyl hydrogen phosphate is sourced from PubChem (CID 87127951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).