C9H10F14O8S2 — CID 87127969
bis(1,1,1,2,3,3,3-heptafluoropropane-2-sulfonic acid);propane-1,2-diol (PubChem CID 87127969) has the molecular formula C9H10F14O8S2 and a molecular weight of 576.28 g/mol. Its IUPAC name is bis(1,1,1,2,3,3,3-heptafluoropropane-2-sulfonic acid);propane-1,2-diol.
| Compound Name | bis(1,1,1,2,3,3,3-heptafluoropropane-2-sulfonic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87127969 |
| Molecular Formula | C9H10F14O8S2 |
| Molecular Weight | 576.28 g/mol |
| Exact Mass | 575.96 |
| IUPAC Name | bis(1,1,1,2,3,3,3-heptafluoropropane-2-sulfonic acid);propane-1,2-diol |
| SMILES | CC(O)CO.O=S(=O)(O)C(F)(C(F)(F)F)C(F)(F)F.O=S(=O)(O)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C3HF7O3S.C3H8O2/c2*4-1(2(5,6)7,3(8,9)10)14(11,12)13;1-3(5)2-4/h2*(H,11,12,13);3-5H,2H2,1H3 |
| InChIKey | DPKWJFFBLQNLRB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|