C11H10F18O8S2 — CID 87127980
bis(1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonic acid);propane-1,2-diol (PubChem CID 87127980) has the molecular formula C11H10F18O8S2 and a molecular weight of 676.29 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonic acid);propane-1,2-diol.
| Compound Name | bis(1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87127980 |
| Molecular Formula | C11H10F18O8S2 |
| Molecular Weight | 676.29 g/mol |
| Exact Mass | 675.95 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonic acid);propane-1,2-diol |
| SMILES | CC(O)CO.O=S(=O)(O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F.O=S(=O)(O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C4HF9O3S.C3H8O2/c2*5-2(6,7)1(3(8,9)10,4(11,12)13)17(14,15)16;1-3(5)2-4/h2*(H,14,15,16);3-5H,2H2,1H3 |
| InChIKey | WIMIHEFDWGJCLN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|