C9H12F12O8S2 — CID 87127993
bis(1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid);propane-1,3-diol (PubChem CID 87127993) has the molecular formula C9H12F12O8S2 and a molecular weight of 540.30 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid);propane-1,3-diol.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid);propane-1,3-diol |
|---|---|
| PubChem CID | 87127993 |
| Molecular Formula | C9H12F12O8S2 |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 539.98 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid);propane-1,3-diol |
| SMILES | O=S(=O)(O)C(C(F)(F)F)C(F)(F)F.O=S(=O)(O)C(C(F)(F)F)C(F)(F)F.OCCCO |
| InChI | InChI=1S/2C3H2F6O3S.C3H8O2/c2*4-2(5,6)1(3(7,8)9)13(10,11)12;4-2-1-3-5/h2*1H,(H,10,11,12);4-5H,1-3H2 |
| InChIKey | KQLVCQFGBQMNEV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|