C11H24F4O8S2 — CID 87128010
bis(1,1-difluoro-2-methylpropane-1-sulfonic acid);propane-1,2-diol (PubChem CID 87128010) has the molecular formula C11H24F4O8S2 and a molecular weight of 424.43 g/mol. Its IUPAC name is bis(1,1-difluoro-2-methylpropane-1-sulfonic acid);propane-1,2-diol.
| Compound Name | bis(1,1-difluoro-2-methylpropane-1-sulfonic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87128010 |
| Molecular Formula | C11H24F4O8S2 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | bis(1,1-difluoro-2-methylpropane-1-sulfonic acid);propane-1,2-diol |
| SMILES | CC(C)C(F)(F)S(=O)(=O)O.CC(C)C(F)(F)S(=O)(=O)O.CC(O)CO |
| InChI | InChI=1S/2C4H8F2O3S.C3H8O2/c2*1-3(2)4(5,6)10(7,8)9;1-3(5)2-4/h2*3H,1-2H3,(H,7,8,9);3-5H,2H2,1H3 |
| InChIKey | ZQLMJOOBQYGPFO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|