About propane-1,2-diol;bis(trifluoromethanesulfonic acid)
propane-1,2-diol;bis(trifluoromethanesulfonic acid) (PubChem CID 87128042) has the molecular formula C5H10F6O8S2
and a molecular weight of 376.25 g/mol. Its IUPAC name is propane-1,2-diol;bis(trifluoromethanesulfonic acid).
Molecular Properties
| Compound Name | propane-1,2-diol;bis(trifluoromethanesulfonic acid) |
| PubChem CID | 87128042 |
| Molecular Formula | C5H10F6O8S2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | propane-1,2-diol;bis(trifluoromethanesulfonic acid) |
| SMILES | CC(O)CO.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C3H8O2.2CHF3O3S/c1-3(5)2-4;2*2-1(3,4)8(5,6)7/h3-5H,2H2,1H3;2*(H,5,6,7) |
| InChIKey | ZTZIZXUFRMVJQR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze propane-1,2-diol;bis(trifluoromethanesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diol;bis(trifluoromethanesulfonic acid)?
The IUPAC name of propane-1,2-diol;bis(trifluoromethanesulfonic acid) (CID 87128042) is propane-1,2-diol;bis(trifluoromethanesulfonic acid).
What is the SMILES notation for propane-1,2-diol;bis(trifluoromethanesulfonic acid)?
The canonical SMILES for propane-1,2-diol;bis(trifluoromethanesulfonic acid) is CC(O)CO.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of propane-1,2-diol;bis(trifluoromethanesulfonic acid)?
The InChIKey is ZTZIZXUFRMVJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.2CHF3O3S/c1-3(5)2-4;2*2-1(3,4)8(5,6)7/h3-5H,2H2,1H3;2*(H,5,6,7).
What are the key properties of propane-1,2-diol;bis(trifluoromethanesulfonic acid)?
propane-1,2-diol;bis(trifluoromethanesulfonic acid) has a molecular weight of 376.25 g/mol, XLogP of 0.15, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diol;bis(trifluoromethanesulfonic acid) is sourced from PubChem (CID 87128042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).