C7H10F10O8S2 — CID 87128063
bis(1,1,2,2,2-pentafluoroethanesulfonic acid);propane-1,2-diol (PubChem CID 87128063) has the molecular formula C7H10F10O8S2 and a molecular weight of 476.26 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethanesulfonic acid);propane-1,2-diol.
| Compound Name | bis(1,1,2,2,2-pentafluoroethanesulfonic acid);propane-1,2-diol |
|---|---|
| PubChem CID | 87128063 |
| Molecular Formula | C7H10F10O8S2 |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 475.97 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethanesulfonic acid);propane-1,2-diol |
| SMILES | CC(O)CO.O=S(=O)(O)C(F)(F)C(F)(F)F.O=S(=O)(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3H8O2.2C2HF5O3S/c1-3(5)2-4;2*3-1(4,5)2(6,7)11(8,9)10/h3-5H,2H2,1H3;2*(H,8,9,10) |
| InChIKey | OFDIGMUTJKRLFB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|