C8H8F10S — CID 87128143
1,1,1,2,2-pentafluoro-3-(3,3,4,4,4-pentafluorobutan-2-ylsulfanyl)butane (PubChem CID 87128143) has the molecular formula C8H8F10S and a molecular weight of 326.20 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-3-(3,3,4,4,4-pentafluorobutan-2-ylsulfanyl)butane.
| Compound Name | 1,1,1,2,2-pentafluoro-3-(3,3,4,4,4-pentafluorobutan-2-ylsulfanyl)butane |
|---|---|
| PubChem CID | 87128143 |
| Molecular Formula | C8H8F10S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-3-(3,3,4,4,4-pentafluorobutan-2-ylsulfanyl)butane |
| SMILES | CC(SC(C)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10S/c1-3(5(9,10)7(13,14)15)19-4(2)6(11,12)8(16,17)18/h3-4H,1-2H3 |
| InChIKey | ATDKHJHPFZOIEZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|