About 1-propylsulfonyloxyethyl propane-1-sulfonate
1-propylsulfonyloxyethyl propane-1-sulfonate (PubChem CID 87128323) has the molecular formula C8H18O6S2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-propylsulfonyloxyethyl propane-1-sulfonate.
Molecular Properties
| Compound Name | 1-propylsulfonyloxyethyl propane-1-sulfonate |
| PubChem CID | 87128323 |
| Molecular Formula | C8H18O6S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-propylsulfonyloxyethyl propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OC(C)OS(=O)(=O)CCC |
| InChI | InChI=1S/C8H18O6S2/c1-4-6-15(9,10)13-8(3)14-16(11,12)7-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | DVZUISKSWQKYMI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-propylsulfonyloxyethyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylsulfonyloxyethyl propane-1-sulfonate?
The IUPAC name of 1-propylsulfonyloxyethyl propane-1-sulfonate (CID 87128323) is 1-propylsulfonyloxyethyl propane-1-sulfonate.
What is the SMILES notation for 1-propylsulfonyloxyethyl propane-1-sulfonate?
The canonical SMILES for 1-propylsulfonyloxyethyl propane-1-sulfonate is CCCS(=O)(=O)OC(C)OS(=O)(=O)CCC.
What is the InChIKey of 1-propylsulfonyloxyethyl propane-1-sulfonate?
The InChIKey is DVZUISKSWQKYMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O6S2/c1-4-6-15(9,10)13-8(3)14-16(11,12)7-5-2/h8H,4-7H2,1-3H3.
What are the key properties of 1-propylsulfonyloxyethyl propane-1-sulfonate?
1-propylsulfonyloxyethyl propane-1-sulfonate has a molecular weight of 274.36 g/mol, XLogP of 0.85, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylsulfonyloxyethyl propane-1-sulfonate is sourced from PubChem (CID 87128323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).