C8H10F8O6S2 — CID 87128388
4-(1,1,2,2-tetrafluoroethylsulfonyloxy)butyl 1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87128388) has the molecular formula C8H10F8O6S2 and a molecular weight of 418.28 g/mol. Its IUPAC name is 4-(1,1,2,2-tetrafluoroethylsulfonyloxy)butyl 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 4-(1,1,2,2-tetrafluoroethylsulfonyloxy)butyl 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87128388 |
| Molecular Formula | C8H10F8O6S2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 4-(1,1,2,2-tetrafluoroethylsulfonyloxy)butyl 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)(OCCCCOS(=O)(=O)C(F)(F)C(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F8O6S2/c9-5(10)7(13,14)23(17,18)21-3-1-2-4-22-24(19,20)8(15,16)6(11)12/h5-6H,1-4H2 |
| InChIKey | MCFRSJUKHXODSM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|