About 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate
11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 87128916) has the molecular formula C30H52O3
and a molecular weight of 460.74 g/mol. Its IUPAC name is 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| PubChem CID | 87128916 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)CCCCCCCCCCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H52O3/c1-23(2)17-15-13-11-9-10-12-14-16-20-33-27(31)19-18-24-21-25(29(3,4)5)28(32)26(22-24)30(6,7)8/h21-23,32H,9-20H2,1-8H3 |
| InChIKey | OLGBEZPVDGIRFI-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate?
The IUPAC name of 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (CID 87128916) is 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
What is the SMILES notation for 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate?
The canonical SMILES for 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate is CC(C)CCCCCCCCCCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate?
The InChIKey is OLGBEZPVDGIRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H52O3/c1-23(2)17-15-13-11-9-10-12-14-16-20-33-27(31)19-18-24-21-25(29(3,4)5)28(32)26(22-24)30(6,7)8/h21-23,32H,9-20H2,1-8H3.
What are the key properties of 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate?
11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate has a molecular weight of 460.74 g/mol, XLogP of 8.63, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyldodecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate is sourced from PubChem (CID 87128916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).