C20H24BF4N2O2- — CID 87128931
(S)-[(2S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol tetrafluoroborate (PubChem CID 87128931) has the molecular formula C20H24BF4N2O2- and a molecular weight of 411.23 g/mol. Its IUPAC name is (S)-[(2S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol tetrafluoroborate.
| Compound Name | (S)-[(2S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol tetrafluoroborate |
|---|---|
| PubChem CID | 87128931 |
| Molecular Formula | C20H24BF4N2O2- |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (S)-[(2S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol tetrafluoroborate |
| SMILES | C=C[C@@H]1CN2CCC1C[C@H]2[C@@H](O)c1ccnc2ccc(OC)cc12.F[B-](F)(F)F |
| InChI | InChI=1S/C20H24N2O2.BF4/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;2-1(3,4)5/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;/q;-1/t13-,14?,19+,20+;/m1./s1 |
| InChIKey | ISLQQFTZAWVXOF-AJQZEYRWSA-N |
| XLogP | 4.47 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|