C19H26N4 — CID 87128951
(10Z,14Z)-2,3,4,5,6,7,8,12,13,17,18,19,21,23-tetradecahydro-1H-corrin (PubChem CID 87128951) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is (10Z,14Z)-2,3,4,5,6,7,8,12,13,17,18,19,21,23-tetradecahydro-1H-corrin.
| Compound Name | (10Z,14Z)-2,3,4,5,6,7,8,12,13,17,18,19,21,23-tetradecahydro-1H-corrin |
|---|---|
| PubChem CID | 87128951 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (10Z,14Z)-2,3,4,5,6,7,8,12,13,17,18,19,21,23-tetradecahydro-1H-corrin |
| SMILES | C1=C2/CC/C(=C/C3=NC(CC3)C3CCC(CC4CCC/1=N4)N3)N2 |
| InChI | InChI=1S/C19H26N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h9-10,15,17-20,23H,1-8,11H2/b12-9-,14-10- |
| InChIKey | MWYFEGFRIBGPPC-DCKTUCEMSA-N |
| XLogP | 2.87 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |