About methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride
methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride (PubChem CID 87129218) has the molecular formula C20H17BrCl2N2O4
and a molecular weight of 500.18 g/mol. Its IUPAC name is methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride |
| PubChem CID | 87129218 |
| Molecular Formula | C20H17BrCl2N2O4 |
| Molecular Weight | 500.18 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccnc(-c2ccc(Cl)cc2)c1.COC(=O)c1ccnc(Br)c1.Cl |
| InChI | InChI=1S/C13H10ClNO2.C7H6BrNO2.ClH/c1-17-13(16)10-6-7-15-12(8-10)9-2-4-11(14)5-3-9;1-11-7(10)5-2-3-9-6(8)4-5;/h2-8H,1H3;2-4H,1H3;1H |
| InChIKey | MMUJVLJEPLOKQG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.18 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride?
The IUPAC name of methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride (CID 87129218) is methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride.
What is the SMILES notation for methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride?
The canonical SMILES for methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride is COC(=O)c1ccnc(-c2ccc(Cl)cc2)c1.COC(=O)c1ccnc(Br)c1.Cl.
What is the InChIKey of methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride?
The InChIKey is MMUJVLJEPLOKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO2.C7H6BrNO2.ClH/c1-17-13(16)10-6-7-15-12(8-10)9-2-4-11(14)5-3-9;1-11-7(10)5-2-3-9-6(8)4-5;/h2-8H,1H3;2-4H,1H3;1H.
What are the key properties of methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride?
methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride has a molecular weight of 500.18 g/mol, XLogP of 5.24, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromopyridine-4-carboxylate;methyl 2-(4-chlorophenyl)pyridine-4-carboxylate;hydrochloride is sourced from PubChem (CID 87129218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).