About methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate
methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate (PubChem CID 87129250) has the molecular formula C21H14ClF5N2O4
and a molecular weight of 488.80 g/mol. Its IUPAC name is methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate |
| PubChem CID | 87129250 |
| Molecular Formula | C21H14ClF5N2O4 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(-c2cc(F)c(C(F)(F)F)c(F)c2)c1.COC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C14H8F5NO2.C7H6ClNO2/c1-22-13(21)7-2-3-20-11(6-7)8-4-9(15)12(10(16)5-8)14(17,18)19;1-11-7(10)5-2-3-9-6(8)4-5/h2-6H,1H3;2-4H,1H3 |
| InChIKey | TVTZCGKTFWLZGB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
The IUPAC name of methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate (CID 87129250) is methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate.
What is the SMILES notation for methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
The canonical SMILES for methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate is COC(=O)c1ccnc(-c2cc(F)c(C(F)(F)F)c(F)c2)c1.COC(=O)c1ccnc(Cl)c1.
What is the InChIKey of methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
The InChIKey is TVTZCGKTFWLZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F5NO2.C7H6ClNO2/c1-22-13(21)7-2-3-20-11(6-7)8-4-9(15)12(10(16)5-8)14(17,18)19;1-11-7(10)5-2-3-9-6(8)4-5/h2-6H,1H3;2-4H,1H3.
What are the key properties of methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate has a molecular weight of 488.80 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloropyridine-4-carboxylate;methyl 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylate is sourced from PubChem (CID 87129250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).