About 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde
4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde (PubChem CID 87129295) has the molecular formula C14H18N4O
and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde |
| PubChem CID | 87129295 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde |
| SMILES | Cc1nn(C)c2ncc(C=O)c(NC3CCCC3)c12 |
| InChI | InChI=1S/C14H18N4O/c1-9-12-13(16-11-5-3-4-6-11)10(8-19)7-15-14(12)18(2)17-9/h7-8,11H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | MGPYMZKLEXKZHF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde?
The IUPAC name of 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde (CID 87129295) is 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde.
What is the SMILES notation for 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde?
The canonical SMILES for 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde is Cc1nn(C)c2ncc(C=O)c(NC3CCCC3)c12.
What is the InChIKey of 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde?
The InChIKey is MGPYMZKLEXKZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O/c1-9-12-13(16-11-5-3-4-6-11)10(8-19)7-15-14(12)18(2)17-9/h7-8,11H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde?
4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde has a molecular weight of 258.32 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbaldehyde is sourced from PubChem (CID 87129295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).