C20H27N3O7S — CID 87130128
(5S)-5-[(2R,3S,5R,6R)-3-(aminomethyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 87130128) has the molecular formula C20H27N3O7S and a molecular weight of 453.52 g/mol. Its IUPAC name is (5S)-5-[(2R,3S,5R,6R)-3-(aminomethyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[(2R,3S,5R,6R)-3-(aminomethyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87130128 |
| Molecular Formula | C20H27N3O7S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (5S)-5-[(2R,3S,5R,6R)-3-(aminomethyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | CO[C@]1(C)O[C@@H]([C@@H]2CN(c3ccc4c(c3)NC(=O)CS4)C(=O)O2)[C@H](CN)O[C@@]1(C)OC |
| InChI | InChI=1S/C20H27N3O7S/c1-19(26-3)20(2,27-4)30-17(13(8-21)29-19)14-9-23(18(25)28-14)11-5-6-15-12(7-11)22-16(24)10-31-15/h5-7,13-14,17H,8-10,21H2,1-4H3,(H,22,24)/t13-,14-,17+,19+,20+/m0/s1 |
| InChIKey | WBLQFAVXRGJHKF-MHFWZCSHSA-N |
| XLogP | 1.52 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |