C9H18F3N3O3 — CID 87130167
N-(3-aminopropyl)-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 87130167) has the molecular formula C9H18F3N3O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-aminopropyl)-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87130167 |
| Molecular Formula | C9H18F3N3O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-(3-aminopropyl)-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CC(=O)NCCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H17N3O.C2HF3O2/c1-10(2)6-7(11)9-5-3-4-8;3-2(4,5)1(6)7/h3-6,8H2,1-2H3,(H,9,11);(H,6,7) |
| InChIKey | CWWDKWOBKXYSNH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|