About 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid
6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 87130256) has the molecular formula C8H8N2O7
and a molecular weight of 244.16 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 87130256 |
| Molecular Formula | C8H8N2O7 |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC1([N+](=O)[O-])C=C([N+](=O)[O-])C=C(C(=O)O)C1O |
| InChI | InChI=1S/C8H8N2O7/c1-8(10(16)17)3-4(9(14)15)2-5(6(8)11)7(12)13/h2-3,6,11H,1H3,(H,12,13) |
| InChIKey | JDYKMSMQKBSHLW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid (CID 87130256) is 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid is CC1([N+](=O)[O-])C=C([N+](=O)[O-])C=C(C(=O)O)C1O.
What is the InChIKey of 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is JDYKMSMQKBSHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O7/c1-8(10(16)17)3-4(9(14)15)2-5(6(8)11)7(12)13/h2-3,6,11H,1H3,(H,12,13).
What are the key properties of 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid?
6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 244.16 g/mol, XLogP of -0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-5-methyl-3,5-dinitrocyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 87130256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).