C30H25F5O7S2 — CID 87130853
5-oxo-1-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;triphenylsulfanium (PubChem CID 87130853) has the molecular formula C30H25F5O7S2 and a molecular weight of 656.65 g/mol. Its IUPAC name is 5-oxo-1-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;triphenylsulfanium.
| Compound Name | 5-oxo-1-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 87130853 |
| Molecular Formula | C30H25F5O7S2 |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | 5-oxo-1-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate;triphenylsulfanium |
| SMILES | O=C1OC2CC3(C(C(F)(F)F)C(F)(F)S(=O)(=O)O)CC2C1C3C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H11F5O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-11(14,15)9(12(16,17)25(21,22)23)10-1-3-4(2-10)24-8(20)5(3)6(10)7(18)19/h1-15H;3-6,9H,1-2H2,(H,18,19)(H,21,22,23)/q+1;/p-1 |
| InChIKey | ZAFUMRSAPDTKFN-UHFFFAOYSA-M |
| XLogP | 4.75 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|