C30H26F5O7S2+ — CID 87130855
1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonic acid;triphenylsulfanium (PubChem CID 87130855) has the molecular formula C30H26F5O7S2+ and a molecular weight of 657.66 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonic acid;triphenylsulfanium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonic acid;triphenylsulfanium |
|---|---|
| PubChem CID | 87130855 |
| Molecular Formula | C30H26F5O7S2+ |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.10 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonic acid;triphenylsulfanium |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)C1C2CC3OC(=O)C1C3C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H11F5O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-11(14,15)10(12(16,17)25(20,21)22)24-8(18)6-3-1-4-5(2-3)23-9(19)7(4)6/h1-15H;3-7,10H,1-2H2,(H,20,21,22)/q+1; |
| InChIKey | YNVPPFVBZHCTOF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|